Cosmetic antibacterial agent Zinc pyrithione with 99% purity CAS 13463-41-7
| Zinc pyrithione Basic information | |
| Product Name: | Zinc pyrithione |
| CAS: | 13463-41-7 |
| MF: | C10H8N2O2S2Zn |
| MW: | 317.7 |
| EINECS: | 236-671-3 |
| Mol File: | 13463-41-7.mol |
| Zinc pyrithione Chemical Properties | |
| Melting point | approximate 240 ºC |
| density | 1.782 g/cm3(Temp: 25 °C) |
| vapor pressure | 0Pa at 25 ºC |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Pyridine |
| form | Powder |
| color | White to Orange to Green |
| Odor | Mild Characteristic |
| Water Solubility | Insoluble (<0.1 g/100 mL at 21 ºC) |
| Merck | 147,994 |
| InChI | InChI=1S/2C5H5NOS.Zn/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,8H;/q;;+2/p-2 |
| InChIKey | OTPSWLRZXRHDNX-UHFFFAOYSA-L |
| SMILES | C1(C=CC=C[N+]=1[O-])S[Zn]SC1C=CC=C[N+]=1[O-] |
| LogP | 0.9 at 25 ºC and pH7.5-7.7 |
| Surface tension | 73mN/m at 7.22mg/L and 20 ºC |
| CAS DataBase Reference | 13463-41-7(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc pyrithione (13463-41-7) |
| Item | Specifications |
| Appearance | White latex |
| Assay | 48-50% |
| PH | 6.5-9.0 |
| Zinc content | 9.3-11.3 % |
| Particle size D 50 , um | <0.5 |
| Particle size D9 0 , um | <1.0 |
| Total heavy metals (as Pb)ppm | ≤20 |